C25H33ClO4Si — CID 11213360
(15-methyl-15-silaheptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-trien-15-yl) perchlorate (PubChem CID 11213360) has the molecular formula C25H33ClO4Si and a molecular weight of 461.07 g/mol. Its IUPAC name is (15-methyl-15-silaheptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-trien-15-yl) perchlorate.
| Compound Name | (15-methyl-15-silaheptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-trien-15-yl) perchlorate |
|---|---|
| PubChem CID | 11213360 |
| Molecular Formula | C25H33ClO4Si |
| Molecular Weight | 461.07 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (15-methyl-15-silaheptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-trien-15-yl) perchlorate |
| SMILES | C[Si]1(O[Cl+3]([O-])([O-])[O-])C2=C(C3=C(C4=C1C1CCC4CC1)C1CCC3CC1)C1CCC2CC1 |
| InChI | InChI=1S/C25H33ClO4Si/c1-31(30-26(27,28)29)24-18-10-6-16(7-11-18)22(24)20-14-2-3-15(5-4-14)21(20)23-17-8-12-19(13-9-17)25(23)31/h14-19H,2-13H2,1H3 |
| InChIKey | FYMXSWJZXDQZMJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.07 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|