C17H28Si2 — CID 10684806
(3-cyclohexylidene-5-trimethylsilylpenta-1,4-diynyl)-trimethylsilane (PubChem CID 10684806) has the molecular formula C17H28Si2 and a molecular weight of 288.58 g/mol. Its IUPAC name is (3-cyclohexylidene-5-trimethylsilylpenta-1,4-diynyl)-trimethylsilane.
| Compound Name | (3-cyclohexylidene-5-trimethylsilylpenta-1,4-diynyl)-trimethylsilane |
|---|---|
| PubChem CID | 10684806 |
| Molecular Formula | C17H28Si2 |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (3-cyclohexylidene-5-trimethylsilylpenta-1,4-diynyl)-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC(C#C[Si](C)(C)C)=C1CCCCC1 |
| InChI | InChI=1S/C17H28Si2/c1-18(2,3)14-12-17(13-15-19(4,5)6)16-10-8-7-9-11-16/h7-11H2,1-6H3 |
| InChIKey | NTCZIAYXXGQTTF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|