C30H56Si2 — CID 11113489
[(E)-3,4-di(propan-2-yl)-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane (PubChem CID 11113489) has the molecular formula C30H56Si2 and a molecular weight of 472.95 g/mol. Its IUPAC name is [(E)-3,4-di(propan-2-yl)-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [(E)-3,4-di(propan-2-yl)-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11113489 |
| Molecular Formula | C30H56Si2 |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | [(E)-3,4-di(propan-2-yl)-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(\C#C[Si](C(C)C)(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C30H56Si2/c1-21(2)29(17-19-31(23(5)6,24(7)8)25(9)10)30(22(3)4)18-20-32(26(11)12,27(13)14)28(15)16/h21-28H,1-16H3/b30-29+ |
| InChIKey | PZUBIALDRSNEQF-QVIHXGFCSA-N |
| XLogP | 10.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|