C32H60Si2 — CID 15448264
[(Z)-3,4-ditert-butyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane (PubChem CID 15448264) has the molecular formula C32H60Si2 and a molecular weight of 501.00 g/mol. Its IUPAC name is [(Z)-3,4-ditert-butyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [(Z)-3,4-ditert-butyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 15448264 |
| Molecular Formula | C32H60Si2 |
| Molecular Weight | 501.00 g/mol |
| Exact Mass | 500.42 |
| IUPAC Name | [(Z)-3,4-ditert-butyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#C/C(=C(\C#C[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H60Si2/c1-23(2)33(24(3)4,25(5)6)21-19-29(31(13,14)15)30(32(16,17)18)20-22-34(26(7)8,27(9)10)28(11)12/h23-28H,1-18H3/b30-29- |
| InChIKey | WIWQXVHIRSPARQ-FLWNBWAVSA-N |
| XLogP | 10.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.00 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|