C48H78Si2 — CID 101212827
tri(propan-2-yl)-[3,5,10,12-tetratert-butyl-14-tri(propan-2-yl)silyltetradeca-3,4,10,11-tetraen-1,6,8,13-tetraynyl]silane (PubChem CID 101212827) has the molecular formula C48H78Si2 and a molecular weight of 711.32 g/mol. Its IUPAC name is tri(propan-2-yl)-[3,5,10,12-tetratert-butyl-14-tri(propan-2-yl)silyltetradeca-3,4,10,11-tetraen-1,6,8,13-tetraynyl]silane.
| Compound Name | tri(propan-2-yl)-[3,5,10,12-tetratert-butyl-14-tri(propan-2-yl)silyltetradeca-3,4,10,11-tetraen-1,6,8,13-tetraynyl]silane |
|---|---|
| PubChem CID | 101212827 |
| Molecular Formula | C48H78Si2 |
| Molecular Weight | 711.32 g/mol |
| Exact Mass | 710.56 |
| IUPAC Name | tri(propan-2-yl)-[3,5,10,12-tetratert-butyl-14-tri(propan-2-yl)silyltetradeca-3,4,10,11-tetraen-1,6,8,13-tetraynyl]silane |
| SMILES | CC(C)[Si](C#CC(=C=C(C#CC#CC(=C=C(C#C[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)C)C(C)(C)C)C(C)(C)C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C48H78Si2/c1-35(2)49(36(3)4,37(5)6)31-29-43(47(19,20)21)33-41(45(13,14)15)27-25-26-28-42(46(16,17)18)34-44(48(22,23)24)30-32-50(38(7)8,39(9)10)40(11)12/h35-40H,1-24H3 |
| InChIKey | PZGCWHINPXQLRU-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.32 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|