C39H58Si — CID 16754262
tri(propan-2-yl)-(3,5,10,12-tetratert-butyltetradeca-3,4,10,11-tetraen-1,6,8,13-tetraynyl)silane (PubChem CID 16754262) has the molecular formula C39H58Si and a molecular weight of 554.98 g/mol. Its IUPAC name is tri(propan-2-yl)-(3,5,10,12-tetratert-butyltetradeca-3,4,10,11-tetraen-1,6,8,13-tetraynyl)silane.
| Compound Name | tri(propan-2-yl)-(3,5,10,12-tetratert-butyltetradeca-3,4,10,11-tetraen-1,6,8,13-tetraynyl)silane |
|---|---|
| PubChem CID | 16754262 |
| Molecular Formula | C39H58Si |
| Molecular Weight | 554.98 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | tri(propan-2-yl)-(3,5,10,12-tetratert-butyltetradeca-3,4,10,11-tetraen-1,6,8,13-tetraynyl)silane |
| SMILES | C#CC(=C=C(C#CC#CC(=C=C(C#C[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)C)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C39H58Si/c1-20-32(36(8,9)10)27-33(37(11,12)13)23-21-22-24-34(38(14,15)16)28-35(39(17,18)19)25-26-40(29(2)3,30(4)5)31(6)7/h1,29-31H,2-19H3 |
| InChIKey | QIQMQSAHABLHPY-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.98 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|