C20H44Si3 — CID 153492761
tert-butyl-[(2E,4Z)-2,4-dimethyl-3,5-bis(trimethylsilyl)hexa-2,4-dienyl]-dimethylsilane (PubChem CID 153492761) has the molecular formula C20H44Si3 and a molecular weight of 368.83 g/mol. Its IUPAC name is tert-butyl-[(2E,4Z)-2,4-dimethyl-3,5-bis(trimethylsilyl)hexa-2,4-dienyl]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4Z)-2,4-dimethyl-3,5-bis(trimethylsilyl)hexa-2,4-dienyl]-dimethylsilane |
|---|---|
| PubChem CID | 153492761 |
| Molecular Formula | C20H44Si3 |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | tert-butyl-[(2E,4Z)-2,4-dimethyl-3,5-bis(trimethylsilyl)hexa-2,4-dienyl]-dimethylsilane |
| SMILES | CC(=C(\C)[Si](C)(C)C)/C(=C(/C)C[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H44Si3/c1-16(15-23(13,14)20(4,5)6)19(22(10,11)12)17(2)18(3)21(7,8)9/h15H2,1-14H3/b18-17-,19-16+ |
| InChIKey | RDTIMDGTRDNPNZ-XTCPURHUSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|