C20H38Si4 — CID 11429239
trimethyl-[(3Z,4Z)-6-trimethylsilyl-3,4-bis(trimethylsilylmethylidene)hexa-1,5-diynyl]silane (PubChem CID 11429239) has the molecular formula C20H38Si4 and a molecular weight of 390.87 g/mol. Its IUPAC name is trimethyl-[(3Z,4Z)-6-trimethylsilyl-3,4-bis(trimethylsilylmethylidene)hexa-1,5-diynyl]silane.
| Compound Name | trimethyl-[(3Z,4Z)-6-trimethylsilyl-3,4-bis(trimethylsilylmethylidene)hexa-1,5-diynyl]silane |
|---|---|
| PubChem CID | 11429239 |
| Molecular Formula | C20H38Si4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | trimethyl-[(3Z,4Z)-6-trimethylsilyl-3,4-bis(trimethylsilylmethylidene)hexa-1,5-diynyl]silane |
| SMILES | C[Si](C)(C)C#CC(=C\[Si](C)(C)C)/C(C#C[Si](C)(C)C)=C/[Si](C)(C)C |
| InChI | InChI=1S/C20H38Si4/c1-21(2,3)15-13-19(17-23(7,8)9)20(18-24(10,11)12)14-16-22(4,5)6/h17-18H,1-12H3/b19-17+,20-18+ |
| InChIKey | FGARCMVMOFSLQS-XPWSMXQVSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|