C24H44Si5 — CID 10950823
trimethyl-(4,4,5,5-tetraethyl-10,10-dimethyl-11-trimethylsilyl-4,5,10-trisilabicyclo[6.3.0]undeca-1(11),8-dien-2,6-diyn-9-yl)silane (PubChem CID 10950823) has the molecular formula C24H44Si5 and a molecular weight of 473.05 g/mol. Its IUPAC name is trimethyl-(4,4,5,5-tetraethyl-10,10-dimethyl-11-trimethylsilyl-4,5,10-trisilabicyclo[6.3.0]undeca-1(11),8-dien-2,6-diyn-9-yl)silane.
| Compound Name | trimethyl-(4,4,5,5-tetraethyl-10,10-dimethyl-11-trimethylsilyl-4,5,10-trisilabicyclo[6.3.0]undeca-1(11),8-dien-2,6-diyn-9-yl)silane |
|---|---|
| PubChem CID | 10950823 |
| Molecular Formula | C24H44Si5 |
| Molecular Weight | 473.05 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | trimethyl-(4,4,5,5-tetraethyl-10,10-dimethyl-11-trimethylsilyl-4,5,10-trisilabicyclo[6.3.0]undeca-1(11),8-dien-2,6-diyn-9-yl)silane |
| SMILES | CC[Si]1(CC)C#CC2=C([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)=C2C#C[Si]1(CC)CC |
| InChI | InChI=1S/C24H44Si5/c1-13-28(14-2)19-17-21-22(18-20-29(28,15-3)16-4)24(26(8,9)10)27(11,12)23(21)25(5,6)7/h13-16H2,1-12H3 |
| InChIKey | VLCFTPBDBBMKGI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.05 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|