C24H48Si4 — CID 102086634
(6E,15E)-1,1,3,3,10,10,12,12-octamethyl-2,11-dimethylidene-1,3,10,12-tetrasilacyclooctadeca-6,15-diene (PubChem CID 102086634) has the molecular formula C24H48Si4 and a molecular weight of 448.99 g/mol. Its IUPAC name is (6E,15E)-1,1,3,3,10,10,12,12-octamethyl-2,11-dimethylidene-1,3,10,12-tetrasilacyclooctadeca-6,15-diene.
| Compound Name | (6E,15E)-1,1,3,3,10,10,12,12-octamethyl-2,11-dimethylidene-1,3,10,12-tetrasilacyclooctadeca-6,15-diene |
|---|---|
| PubChem CID | 102086634 |
| Molecular Formula | C24H48Si4 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (6E,15E)-1,1,3,3,10,10,12,12-octamethyl-2,11-dimethylidene-1,3,10,12-tetrasilacyclooctadeca-6,15-diene |
| SMILES | C=C1[Si](C)(C)CC/C=C/CC[Si](C)(C)C(=C)[Si](C)(C)CC/C=C/CC[Si]1(C)C |
| InChI | InChI=1S/C24H48Si4/c1-23-25(3,4)19-15-11-13-17-21-27(7,8)24(2)28(9,10)22-18-14-12-16-20-26(23,5)6/h11-14H,1-2,15-22H2,3-10H3/b13-11+,14-12+ |
| InChIKey | GJFJRXLVWOZLIZ-PHEQNACWSA-N |
| XLogP | 8.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|