C24H36Si4 — CID 134976988
trimethyl-[8-trimethylsilyl-3,6-bis(2-trimethylsilylethynyl)octa-3,4,5-trien-1,7-diynyl]silane (PubChem CID 134976988) has the molecular formula C24H36Si4 and a molecular weight of 436.90 g/mol. Its IUPAC name is trimethyl-[8-trimethylsilyl-3,6-bis(2-trimethylsilylethynyl)octa-3,4,5-trien-1,7-diynyl]silane.
| Compound Name | trimethyl-[8-trimethylsilyl-3,6-bis(2-trimethylsilylethynyl)octa-3,4,5-trien-1,7-diynyl]silane |
|---|---|
| PubChem CID | 134976988 |
| Molecular Formula | C24H36Si4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | trimethyl-[8-trimethylsilyl-3,6-bis(2-trimethylsilylethynyl)octa-3,4,5-trien-1,7-diynyl]silane |
| SMILES | C[Si](C)(C)C#CC(=C=C=C(C#C[Si](C)(C)C)C#C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C24H36Si4/c1-25(2,3)19-15-23(16-20-26(4,5)6)13-14-24(17-21-27(7,8)9)18-22-28(10,11)12/h1-12H3 |
| InChIKey | LUOYTWIJZGHZRO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|