C17H35ISi2 — CID 177496033
[(E,4E)-4-[iodo(trimethylsilyl)methylidene]dec-2-en-2-yl]-trimethylsilane (PubChem CID 177496033) has the molecular formula C17H35ISi2 and a molecular weight of 422.54 g/mol. Its IUPAC name is [(E,4E)-4-[iodo(trimethylsilyl)methylidene]dec-2-en-2-yl]-trimethylsilane.
| Compound Name | [(E,4E)-4-[iodo(trimethylsilyl)methylidene]dec-2-en-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177496033 |
| Molecular Formula | C17H35ISi2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [(E,4E)-4-[iodo(trimethylsilyl)methylidene]dec-2-en-2-yl]-trimethylsilane |
| SMILES | CCCCCCC(/C=C(\C)[Si](C)(C)C)=C(\I)[Si](C)(C)C |
| InChI | InChI=1S/C17H35ISi2/c1-9-10-11-12-13-16(17(18)20(6,7)8)14-15(2)19(3,4)5/h14H,9-13H2,1-8H3/b15-14+,17-16- |
| InChIKey | XOLOMCIUDFGWNU-FZIQOSRTSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|