C17H32I2Si — CID 134888022
[(1Z,3Z)-2-butyl-1,4-diiodo-3-propylhepta-1,3-dienyl]-trimethylsilane (PubChem CID 134888022) has the molecular formula C17H32I2Si and a molecular weight of 518.34 g/mol. Its IUPAC name is [(1Z,3Z)-2-butyl-1,4-diiodo-3-propylhepta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1Z,3Z)-2-butyl-1,4-diiodo-3-propylhepta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 134888022 |
| Molecular Formula | C17H32I2Si |
| Molecular Weight | 518.34 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | [(1Z,3Z)-2-butyl-1,4-diiodo-3-propylhepta-1,3-dienyl]-trimethylsilane |
| SMILES | CCCCC(/C(CCC)=C(\I)CCC)=C(/I)[Si](C)(C)C |
| InChI | InChI=1S/C17H32I2Si/c1-7-10-13-15(17(19)20(4,5)6)14(11-8-2)16(18)12-9-3/h7-13H2,1-6H3/b16-14-,17-15+ |
| InChIKey | NZAVXLKSFWYVEU-QUDUTFMFSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.34 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|