C17H32Li2Si — CID 134888103
dilithium;(2-butyl-3-propylhepta-1,3-dienyl)-trimethylsilane (PubChem CID 134888103) has the molecular formula C17H32Li2Si and a molecular weight of 278.41 g/mol. Its IUPAC name is dilithium;(2-butyl-3-propylhepta-1,3-dienyl)-trimethylsilane.
| Compound Name | dilithium;(2-butyl-3-propylhepta-1,3-dienyl)-trimethylsilane |
|---|---|
| PubChem CID | 134888103 |
| Molecular Formula | C17H32Li2Si |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | dilithium;(2-butyl-3-propylhepta-1,3-dienyl)-trimethylsilane |
| SMILES | CCC/[C-]=C(CCC)/C(=[C-]/[Si](C)(C)C)CCCC.[Li+].[Li+] |
| InChI | InChI=1S/C17H32Si.2Li/c1-7-10-13-16(12-9-3)17(14-11-8-2)15-18(4,5)6;;/h7-12,14H2,1-6H3;;/q-2;2*+1 |
| InChIKey | JTTYONOWWPDJEU-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|