C20H36Li2 — CID 12982544
dilithium;6,7-dibutyldodeca-5,7-diene (PubChem CID 12982544) has the molecular formula C20H36Li2 and a molecular weight of 290.39 g/mol. Its IUPAC name is dilithium;6,7-dibutyldodeca-5,7-diene.
| Compound Name | dilithium;6,7-dibutyldodeca-5,7-diene |
|---|---|
| PubChem CID | 12982544 |
| Molecular Formula | C20H36Li2 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.31 |
| IUPAC Name | dilithium;6,7-dibutyldodeca-5,7-diene |
| SMILES | CCCC/[C-]=C(CCCC)/C(=[C-]/CCCC)CCCC.[Li+].[Li+] |
| InChI | InChI=1S/C20H36.2Li/c1-5-9-13-17-19(15-11-7-3)20(16-12-8-4)18-14-10-6-2;;/h5-16H2,1-4H3;;/q-2;2*+1 |
| InChIKey | SYXRHTUSCNBESG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|