C16H28Li2 — CID 11172360
dilithium;5,6-dipropyldeca-4,6-diene (PubChem CID 11172360) has the molecular formula C16H28Li2 and a molecular weight of 234.28 g/mol. Its IUPAC name is dilithium;5,6-dipropyldeca-4,6-diene.
| Compound Name | dilithium;5,6-dipropyldeca-4,6-diene |
|---|---|
| PubChem CID | 11172360 |
| Molecular Formula | C16H28Li2 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.25 |
| IUPAC Name | dilithium;5,6-dipropyldeca-4,6-diene |
| SMILES | CCC/[C-]=C(CCC)/C(=[C-]/CCC)CCC.[Li+].[Li+] |
| InChI | InChI=1S/C16H28.2Li/c1-5-9-13-15(11-7-3)16(12-8-4)14-10-6-2;;/h5-12H2,1-4H3;;/q-2;2*+1 |
| InChIKey | FEUVJPSINKULRT-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|