C12H20Li2 — CID 11423896
dilithium;4,5-diethylocta-3,5-diene (PubChem CID 11423896) has the molecular formula C12H20Li2 and a molecular weight of 178.17 g/mol. Its IUPAC name is dilithium;4,5-diethylocta-3,5-diene.
| Compound Name | dilithium;4,5-diethylocta-3,5-diene |
|---|---|
| PubChem CID | 11423896 |
| Molecular Formula | C12H20Li2 |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.19 |
| IUPAC Name | dilithium;4,5-diethylocta-3,5-diene |
| SMILES | CC/[C-]=C(CC)/C(=[C-]/CC)CC.[Li+].[Li+] |
| InChI | InChI=1S/C12H20.2Li/c1-5-9-11(7-3)12(8-4)10-6-2;;/h5-8H2,1-4H3;;/q-2;2*+1 |
| InChIKey | MTYOQUYSJJGCQK-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|