C16H26 — CID 14291121
3,4-dimethylidene-1,2-dipentylcyclobutene (PubChem CID 14291121) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 3,4-dimethylidene-1,2-dipentylcyclobutene.
| Compound Name | 3,4-dimethylidene-1,2-dipentylcyclobutene |
|---|---|
| PubChem CID | 14291121 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 3,4-dimethylidene-1,2-dipentylcyclobutene |
| SMILES | C=C1C(=C)C(CCCCC)=C1CCCCC |
| InChI | InChI=1S/C16H26/c1-5-7-9-11-15-13(3)14(4)16(15)12-10-8-6-2/h3-12H2,1-2H3 |
| InChIKey | XIBDZBDLASSHLU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|