C16H30 — CID 11123092
5,6-dipropyldeca-4,6-diene (PubChem CID 11123092) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 5,6-dipropyldeca-4,6-diene.
| Compound Name | 5,6-dipropyldeca-4,6-diene |
|---|---|
| PubChem CID | 11123092 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 5,6-dipropyldeca-4,6-diene |
| SMILES | CCCC=C(CCC)C(=CCCC)CCC |
| InChI | InChI=1S/C16H30/c1-5-9-13-15(11-7-3)16(12-8-4)14-10-6-2/h13-14H,5-12H2,1-4H3 |
| InChIKey | KSJCIAUDPFFNTB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|