About dilithium;5-but-2-en-2-yldec-5-ene
dilithium;5-but-2-en-2-yldec-5-ene (PubChem CID 164665606) has the molecular formula C14H24Li2
and a molecular weight of 206.23 g/mol. Its IUPAC name is dilithium;5-but-2-en-2-yldec-5-ene.
Molecular Properties
| Compound Name | dilithium;5-but-2-en-2-yldec-5-ene |
| PubChem CID | 164665606 |
| Molecular Formula | C14H24Li2 |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.22 |
| IUPAC Name | dilithium;5-but-2-en-2-yldec-5-ene |
| SMILES | C/[C-]=C(C)\C(=[C-]\CCCC)CCCC.[Li+].[Li+] |
| InChI | InChI=1S/C14H24.2Li/c1-5-8-10-12-14(11-9-6-2)13(4)7-3;;/h5-6,8-11H2,1-4H3;;/q-2;2*+1 |
| InChIKey | FCIUBWIZHVWHSH-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dilithium;5-but-2-en-2-yldec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;5-but-2-en-2-yldec-5-ene?
The IUPAC name of dilithium;5-but-2-en-2-yldec-5-ene (CID 164665606) is dilithium;5-but-2-en-2-yldec-5-ene.
What is the SMILES notation for dilithium;5-but-2-en-2-yldec-5-ene?
The canonical SMILES for dilithium;5-but-2-en-2-yldec-5-ene is C/[C-]=C(C)\C(=[C-]\CCCC)CCCC.[Li+].[Li+].
What is the InChIKey of dilithium;5-but-2-en-2-yldec-5-ene?
The InChIKey is FCIUBWIZHVWHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24.2Li/c1-5-8-10-12-14(11-9-6-2)13(4)7-3;;/h5-6,8-11H2,1-4H3;;/q-2;2*+1.
What are the key properties of dilithium;5-but-2-en-2-yldec-5-ene?
dilithium;5-but-2-en-2-yldec-5-ene has a molecular weight of 206.23 g/mol, XLogP of -1.13, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;5-but-2-en-2-yldec-5-ene is sourced from PubChem (CID 164665606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).