About dilithium;1,2-di(butylidene)cyclohexane
dilithium;1,2-di(butylidene)cyclohexane (PubChem CID 11241150) has the molecular formula C14H22Li2
and a molecular weight of 204.21 g/mol. Its IUPAC name is dilithium;1,2-di(butylidene)cyclohexane.
Molecular Properties
| Compound Name | dilithium;1,2-di(butylidene)cyclohexane |
| PubChem CID | 11241150 |
| Molecular Formula | C14H22Li2 |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.20 |
| IUPAC Name | dilithium;1,2-di(butylidene)cyclohexane |
| SMILES | CCC/[C-]=C1\CCCC\C1=[C-]/CCC.[Li+].[Li+] |
| InChI | InChI=1S/C14H22.2Li/c1-3-5-9-13-11-7-8-12-14(13)10-6-4-2;;/h3-8,11-12H2,1-2H3;;/q-2;2*+1 |
| InChIKey | PWRBJUSKRWPUND-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dilithium;1,2-di(butylidene)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;1,2-di(butylidene)cyclohexane?
The IUPAC name of dilithium;1,2-di(butylidene)cyclohexane (CID 11241150) is dilithium;1,2-di(butylidene)cyclohexane.
What is the SMILES notation for dilithium;1,2-di(butylidene)cyclohexane?
The canonical SMILES for dilithium;1,2-di(butylidene)cyclohexane is CCC/[C-]=C1\CCCC\C1=[C-]/CCC.[Li+].[Li+].
What is the InChIKey of dilithium;1,2-di(butylidene)cyclohexane?
The InChIKey is PWRBJUSKRWPUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.2Li/c1-3-5-9-13-11-7-8-12-14(13)10-6-4-2;;/h3-8,11-12H2,1-2H3;;/q-2;2*+1.
What are the key properties of dilithium;1,2-di(butylidene)cyclohexane?
dilithium;1,2-di(butylidene)cyclohexane has a molecular weight of 204.21 g/mol, XLogP of -1.37, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;1,2-di(butylidene)cyclohexane is sourced from PubChem (CID 11241150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).