About 3-nonan-5-ylidene-1,2-dipropylcyclobutene
3-nonan-5-ylidene-1,2-dipropylcyclobutene (PubChem CID 138963747) has the molecular formula C19H34
and a molecular weight of 262.48 g/mol. Its IUPAC name is 3-nonan-5-ylidene-1,2-dipropylcyclobutene.
Molecular Properties
| Compound Name | 3-nonan-5-ylidene-1,2-dipropylcyclobutene |
| PubChem CID | 138963747 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | 3-nonan-5-ylidene-1,2-dipropylcyclobutene |
| SMILES | CCCCC(CCCC)=C1CC(CCC)=C1CCC |
| InChI | InChI=1S/C19H34/c1-5-9-13-16(14-10-6-2)19-15-17(11-7-3)18(19)12-8-4/h5-15H2,1-4H3 |
| InChIKey | XVZZPESJILAWGF-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-nonan-5-ylidene-1,2-dipropylcyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonan-5-ylidene-1,2-dipropylcyclobutene?
The IUPAC name of 3-nonan-5-ylidene-1,2-dipropylcyclobutene (CID 138963747) is 3-nonan-5-ylidene-1,2-dipropylcyclobutene.
What is the SMILES notation for 3-nonan-5-ylidene-1,2-dipropylcyclobutene?
The canonical SMILES for 3-nonan-5-ylidene-1,2-dipropylcyclobutene is CCCCC(CCCC)=C1CC(CCC)=C1CCC.
What is the InChIKey of 3-nonan-5-ylidene-1,2-dipropylcyclobutene?
The InChIKey is XVZZPESJILAWGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34/c1-5-9-13-16(14-10-6-2)19-15-17(11-7-3)18(19)12-8-4/h5-15H2,1-4H3.
What are the key properties of 3-nonan-5-ylidene-1,2-dipropylcyclobutene?
3-nonan-5-ylidene-1,2-dipropylcyclobutene has a molecular weight of 262.48 g/mol, XLogP of 6.96, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonan-5-ylidene-1,2-dipropylcyclobutene is sourced from PubChem (CID 138963747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).