About dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane
dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane (PubChem CID 134888331) has the molecular formula C18H36Li2Si2
and a molecular weight of 322.54 g/mol. Its IUPAC name is dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane |
| PubChem CID | 134888331 |
| Molecular Formula | C18H36Li2Si2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane |
| SMILES | CCCCC(=[C-]\[Si](C)(C)C)/C(=[C-]/[Si](C)(C)C)CCCC.[Li+].[Li+] |
| InChI | InChI=1S/C18H36Si2.2Li/c1-9-11-13-17(15-19(3,4)5)18(14-12-10-2)16-20(6,7)8;;/h9-14H2,1-8H3;;/q-2;2*+1 |
| InChIKey | LEXBUBWBQOBWFR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane?
The IUPAC name of dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane (CID 134888331) is dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane.
What is the SMILES notation for dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane?
The canonical SMILES for dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane is CCCCC(=[C-]\[Si](C)(C)C)/C(=[C-]/[Si](C)(C)C)CCCC.[Li+].[Li+].
What is the InChIKey of dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane?
The InChIKey is LEXBUBWBQOBWFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36Si2.2Li/c1-9-11-13-17(15-19(3,4)5)18(14-12-10-2)16-20(6,7)8;;/h9-14H2,1-8H3;;/q-2;2*+1.
What are the key properties of dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane?
dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane has a molecular weight of 322.54 g/mol, XLogP of 0.59, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;[2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane is sourced from PubChem (CID 134888331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).