C24H40Li2Si2 — CID 139249962
dilithium;[3-[[dimethyl(pent-1-ynyl)silyl]methylidene]-2-propylhex-1-enyl]-dimethyl-pent-1-ynylsilane (PubChem CID 139249962) has the molecular formula C24H40Li2Si2 and a molecular weight of 398.64 g/mol. Its IUPAC name is dilithium;[3-[[dimethyl(pent-1-ynyl)silyl]methylidene]-2-propylhex-1-enyl]-dimethyl-pent-1-ynylsilane.
| Compound Name | dilithium;[3-[[dimethyl(pent-1-ynyl)silyl]methylidene]-2-propylhex-1-enyl]-dimethyl-pent-1-ynylsilane |
|---|---|
| PubChem CID | 139249962 |
| Molecular Formula | C24H40Li2Si2 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | dilithium;[3-[[dimethyl(pent-1-ynyl)silyl]methylidene]-2-propylhex-1-enyl]-dimethyl-pent-1-ynylsilane |
| SMILES | CCCC#C[Si](C)(C)/[C-]=C(CCC)/C(=[C-]/[Si](C)(C)C#CCCC)CCC.[Li+].[Li+] |
| InChI | InChI=1S/C24H40Si2.2Li/c1-9-13-15-19-25(5,6)21-23(17-11-3)24(18-12-4)22-26(7,8)20-16-14-10-2;;/h9-14,17-18H2,1-8H3;;/q-2;2*+1 |
| InChIKey | DQYBZJKTECEVKW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|