C26H48Si — CID 86216613
3,5-dibutylnona-3,4-dien-1-ynyl-tri(propan-2-yl)silane (PubChem CID 86216613) has the molecular formula C26H48Si and a molecular weight of 388.76 g/mol. Its IUPAC name is 3,5-dibutylnona-3,4-dien-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3,5-dibutylnona-3,4-dien-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 86216613 |
| Molecular Formula | C26H48Si |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 388.35 |
| IUPAC Name | 3,5-dibutylnona-3,4-dien-1-ynyl-tri(propan-2-yl)silane |
| SMILES | CCCCC(=C=C(CCCC)CCCC)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H48Si/c1-10-13-16-25(17-14-11-2)21-26(18-15-12-3)19-20-27(22(4)5,23(6)7)24(8)9/h22-24H,10-18H2,1-9H3 |
| InChIKey | PKCOTQAEDINQOF-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|