C37H68Si2 — CID 12027353
[3-hexyl-5-[2-tri(propan-2-yl)silylethynyl]undeca-3,4-dien-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 12027353) has the molecular formula C37H68Si2 and a molecular weight of 569.12 g/mol. Its IUPAC name is [3-hexyl-5-[2-tri(propan-2-yl)silylethynyl]undeca-3,4-dien-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [3-hexyl-5-[2-tri(propan-2-yl)silylethynyl]undeca-3,4-dien-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 12027353 |
| Molecular Formula | C37H68Si2 |
| Molecular Weight | 569.12 g/mol |
| Exact Mass | 568.49 |
| IUPAC Name | [3-hexyl-5-[2-tri(propan-2-yl)silylethynyl]undeca-3,4-dien-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | CCCCCCC(=C=C(C#C[Si](C(C)C)(C(C)C)C(C)C)CCCCCC)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H68Si2/c1-15-17-19-21-23-36(25-27-38(30(3)4,31(5)6)32(7)8)29-37(24-22-20-18-16-2)26-28-39(33(9)10,34(11)12)35(13)14/h30-35H,15-24H2,1-14H3 |
| InChIKey | NFNYSUHFZBQOTI-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.12 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|