C24H44I2 — CID 134887868
(6Z,8Z)-6,9-diiodo-7,8-dipentyltetradeca-6,8-diene (PubChem CID 134887868) has the molecular formula C24H44I2 and a molecular weight of 586.42 g/mol. Its IUPAC name is (6Z,8Z)-6,9-diiodo-7,8-dipentyltetradeca-6,8-diene.
| Compound Name | (6Z,8Z)-6,9-diiodo-7,8-dipentyltetradeca-6,8-diene |
|---|---|
| PubChem CID | 134887868 |
| Molecular Formula | C24H44I2 |
| Molecular Weight | 586.42 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | (6Z,8Z)-6,9-diiodo-7,8-dipentyltetradeca-6,8-diene |
| SMILES | CCCCC/C(I)=C(CCCCC)/C(CCCCC)=C(\I)CCCCC |
| InChI | InChI=1S/C24H44I2/c1-5-9-13-17-21(23(25)19-15-11-7-3)22(18-14-10-6-2)24(26)20-16-12-8-4/h5-20H2,1-4H3/b23-21-,24-22- |
| InChIKey | TURQZYPYDJPONY-SXAUZNKPSA-N |
| XLogP | 10.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.42 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|