C16H28I2 — CID 135039011
(3Z,5Z)-5-butyl-4-ethyl-3,6-diiododeca-3,5-diene (PubChem CID 135039011) has the molecular formula C16H28I2 and a molecular weight of 474.21 g/mol. Its IUPAC name is (3Z,5Z)-5-butyl-4-ethyl-3,6-diiododeca-3,5-diene.
| Compound Name | (3Z,5Z)-5-butyl-4-ethyl-3,6-diiododeca-3,5-diene |
|---|---|
| PubChem CID | 135039011 |
| Molecular Formula | C16H28I2 |
| Molecular Weight | 474.21 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | (3Z,5Z)-5-butyl-4-ethyl-3,6-diiododeca-3,5-diene |
| SMILES | CCCC/C(I)=C(CCCC)/C(CC)=C(\I)CC |
| InChI | InChI=1S/C16H28I2/c1-5-9-11-14(16(18)12-10-6-2)13(7-3)15(17)8-4/h5-12H2,1-4H3/b15-13-,16-14- |
| InChIKey | HTSJJBMJUSSIEP-VMNXYWKNSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.21 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|