C14H24I2 — CID 15329312
(3Z,5Z)-4-ethyl-3,6-diiodo-5-propylnona-3,5-diene (PubChem CID 15329312) has the molecular formula C14H24I2 and a molecular weight of 446.15 g/mol. Its IUPAC name is (3Z,5Z)-4-ethyl-3,6-diiodo-5-propylnona-3,5-diene.
| Compound Name | (3Z,5Z)-4-ethyl-3,6-diiodo-5-propylnona-3,5-diene |
|---|---|
| PubChem CID | 15329312 |
| Molecular Formula | C14H24I2 |
| Molecular Weight | 446.15 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | (3Z,5Z)-4-ethyl-3,6-diiodo-5-propylnona-3,5-diene |
| SMILES | CCC/C(I)=C(CCC)/C(CC)=C(\I)CC |
| InChI | InChI=1S/C14H24I2/c1-5-9-12(14(16)10-6-2)11(7-3)13(15)8-4/h5-10H2,1-4H3/b13-11-,14-12- |
| InChIKey | ACMYHTAQVAABPM-XSYHWHKQSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.15 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|