C10H17I — CID 101263094
(E,4Z)-4-(iodomethylidene)non-2-ene (PubChem CID 101263094) has the molecular formula C10H17I and a molecular weight of 264.15 g/mol. Its IUPAC name is (E,4Z)-4-(iodomethylidene)non-2-ene.
| Compound Name | (E,4Z)-4-(iodomethylidene)non-2-ene |
|---|---|
| PubChem CID | 101263094 |
| Molecular Formula | C10H17I |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (E,4Z)-4-(iodomethylidene)non-2-ene |
| SMILES | C/C=C/C(=C\I)CCCCC |
| InChI | InChI=1S/C10H17I/c1-3-5-6-8-10(9-11)7-4-2/h4,7,9H,3,5-6,8H2,1-2H3/b7-4+,10-9+ |
| InChIKey | MDDGIYDXZXWDAF-OXSFDCBASA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|