About 4,5-diethyl-3,6-diiodoocta-3,5-diene
4,5-diethyl-3,6-diiodoocta-3,5-diene (PubChem CID 71339615) has the molecular formula C12H20I2
and a molecular weight of 418.10 g/mol. Its IUPAC name is 4,5-diethyl-3,6-diiodoocta-3,5-diene.
Molecular Properties
| Compound Name | 4,5-diethyl-3,6-diiodoocta-3,5-diene |
| PubChem CID | 71339615 |
| Molecular Formula | C12H20I2 |
| Molecular Weight | 418.10 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | 4,5-diethyl-3,6-diiodoocta-3,5-diene |
| SMILES | CCC(I)=C(CC)C(CC)=C(I)CC |
| InChI | InChI=1S/C12H20I2/c1-5-9(11(13)7-3)10(6-2)12(14)8-4/h5-8H2,1-4H3 |
| InChIKey | OQMGWWJOZTYWQP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.10 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diethyl-3,6-diiodoocta-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethyl-3,6-diiodoocta-3,5-diene?
The IUPAC name of 4,5-diethyl-3,6-diiodoocta-3,5-diene (CID 71339615) is 4,5-diethyl-3,6-diiodoocta-3,5-diene.
What is the SMILES notation for 4,5-diethyl-3,6-diiodoocta-3,5-diene?
The canonical SMILES for 4,5-diethyl-3,6-diiodoocta-3,5-diene is CCC(I)=C(CC)C(CC)=C(I)CC.
What is the InChIKey of 4,5-diethyl-3,6-diiodoocta-3,5-diene?
The InChIKey is OQMGWWJOZTYWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20I2/c1-5-9(11(13)7-3)10(6-2)12(14)8-4/h5-8H2,1-4H3.
What are the key properties of 4,5-diethyl-3,6-diiodoocta-3,5-diene?
4,5-diethyl-3,6-diiodoocta-3,5-diene has a molecular weight of 418.10 g/mol, XLogP of 6.00, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethyl-3,6-diiodoocta-3,5-diene is sourced from PubChem (CID 71339615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).