C8H12I2 — CID 11013883
(2Z,4Z)-2,5-diiodo-3,4-dimethylhexa-2,4-diene (PubChem CID 11013883) has the molecular formula C8H12I2 and a molecular weight of 361.99 g/mol. Its IUPAC name is (2Z,4Z)-2,5-diiodo-3,4-dimethylhexa-2,4-diene.
| Compound Name | (2Z,4Z)-2,5-diiodo-3,4-dimethylhexa-2,4-diene |
|---|---|
| PubChem CID | 11013883 |
| Molecular Formula | C8H12I2 |
| Molecular Weight | 361.99 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | (2Z,4Z)-2,5-diiodo-3,4-dimethylhexa-2,4-diene |
| SMILES | C/C(I)=C(C)/C(C)=C(/C)I |
| InChI | InChI=1S/C8H12I2/c1-5(7(3)9)6(2)8(4)10/h1-4H3/b7-5-,8-6- |
| InChIKey | UNBPDXNGISPTCG-SFECMWDFSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.99 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|