C12H20I2 — CID 11112540
(3Z,5Z)-4,5-diethyl-3,6-diiodoocta-3,5-diene (PubChem CID 11112540) has the molecular formula C12H20I2 and a molecular weight of 418.10 g/mol. Its IUPAC name is (3Z,5Z)-4,5-diethyl-3,6-diiodoocta-3,5-diene.
| Compound Name | (3Z,5Z)-4,5-diethyl-3,6-diiodoocta-3,5-diene |
|---|---|
| PubChem CID | 11112540 |
| Molecular Formula | C12H20I2 |
| Molecular Weight | 418.10 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | (3Z,5Z)-4,5-diethyl-3,6-diiodoocta-3,5-diene |
| SMILES | CC/C(I)=C(CC)/C(CC)=C(\I)CC |
| InChI | InChI=1S/C12H20I2/c1-5-9(11(13)7-3)10(6-2)12(14)8-4/h5-8H2,1-4H3/b11-9-,12-10- |
| InChIKey | OQMGWWJOZTYWQP-HWAYABPNSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.10 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|