C20H36I2 — CID 11635110
(5Z,7Z)-6,7-dibutyl-5,8-diiodododeca-5,7-diene (PubChem CID 11635110) has the molecular formula C20H36I2 and a molecular weight of 530.32 g/mol. Its IUPAC name is (5Z,7Z)-6,7-dibutyl-5,8-diiodododeca-5,7-diene.
| Compound Name | (5Z,7Z)-6,7-dibutyl-5,8-diiodododeca-5,7-diene |
|---|---|
| PubChem CID | 11635110 |
| Molecular Formula | C20H36I2 |
| Molecular Weight | 530.32 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | (5Z,7Z)-6,7-dibutyl-5,8-diiodododeca-5,7-diene |
| SMILES | CCCC/C(I)=C(CCCC)/C(CCCC)=C(\I)CCCC |
| InChI | InChI=1S/C20H36I2/c1-5-9-13-17(19(21)15-11-7-3)18(14-10-6-2)20(22)16-12-8-4/h5-16H2,1-4H3/b19-17-,20-18- |
| InChIKey | BHDPYZPPMLFIIC-CLFAGFIQSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.32 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|