C16H28I2 — CID 11488324
(4Z,6Z)-4,7-diiodo-5,6-dipropyldeca-4,6-diene (PubChem CID 11488324) has the molecular formula C16H28I2 and a molecular weight of 474.21 g/mol. Its IUPAC name is (4Z,6Z)-4,7-diiodo-5,6-dipropyldeca-4,6-diene.
| Compound Name | (4Z,6Z)-4,7-diiodo-5,6-dipropyldeca-4,6-diene |
|---|---|
| PubChem CID | 11488324 |
| Molecular Formula | C16H28I2 |
| Molecular Weight | 474.21 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | (4Z,6Z)-4,7-diiodo-5,6-dipropyldeca-4,6-diene |
| SMILES | CCC/C(I)=C(CCC)/C(CCC)=C(\I)CCC |
| InChI | InChI=1S/C16H28I2/c1-5-9-13(15(17)11-7-3)14(10-6-2)16(18)12-8-4/h5-12H2,1-4H3/b15-13-,16-14- |
| InChIKey | CXGJMHFBKLLISL-VMNXYWKNSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.21 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|