C14H22I2 — CID 11270713
(1Z,2Z)-1,2-bis(1-iodobutylidene)cyclohexane (PubChem CID 11270713) has the molecular formula C14H22I2 and a molecular weight of 444.14 g/mol. Its IUPAC name is (1Z,2Z)-1,2-bis(1-iodobutylidene)cyclohexane.
| Compound Name | (1Z,2Z)-1,2-bis(1-iodobutylidene)cyclohexane |
|---|---|
| PubChem CID | 11270713 |
| Molecular Formula | C14H22I2 |
| Molecular Weight | 444.14 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | (1Z,2Z)-1,2-bis(1-iodobutylidene)cyclohexane |
| SMILES | CCC/C(I)=C1\CCCC\C1=C(\I)CCC |
| InChI | InChI=1S/C14H22I2/c1-3-7-13(15)11-9-5-6-10-12(11)14(16)8-4-2/h3-10H2,1-2H3/b13-11-,14-12- |
| InChIKey | QVJVSVTVGJESGH-XSYHWHKQSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.14 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|