About (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane
(2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane (PubChem CID 13234788) has the molecular formula C14H20I2
and a molecular weight of 442.12 g/mol. Its IUPAC name is (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane.
Molecular Properties
| Compound Name | (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane |
| PubChem CID | 13234788 |
| Molecular Formula | C14H20I2 |
| Molecular Weight | 442.12 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane |
| SMILES | IC(=C1CCCCC1)C(I)=C1CCCCC1 |
| InChI | InChI=1S/C14H20I2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H2 |
| InChIKey | CEJAJMGUTQTTQI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.12 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane?
The IUPAC name of (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane (CID 13234788) is (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane.
What is the SMILES notation for (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane?
The canonical SMILES for (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane is IC(=C1CCCCC1)C(I)=C1CCCCC1.
What is the InChIKey of (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane?
The InChIKey is CEJAJMGUTQTTQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20I2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H2.
What are the key properties of (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane?
(2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane has a molecular weight of 442.12 g/mol, XLogP of 6.29, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexylidene-1,2-diiodoethylidene)cyclohexane is sourced from PubChem (CID 13234788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).