C12H18I2 — CID 102266767
(1Z,2Z)-1,2-bis(1-iodopropylidene)cyclohexane (PubChem CID 102266767) has the molecular formula C12H18I2 and a molecular weight of 416.08 g/mol. Its IUPAC name is (1Z,2Z)-1,2-bis(1-iodopropylidene)cyclohexane.
| Compound Name | (1Z,2Z)-1,2-bis(1-iodopropylidene)cyclohexane |
|---|---|
| PubChem CID | 102266767 |
| Molecular Formula | C12H18I2 |
| Molecular Weight | 416.08 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | (1Z,2Z)-1,2-bis(1-iodopropylidene)cyclohexane |
| SMILES | CC/C(I)=C1\CCCC\C1=C(\I)CC |
| InChI | InChI=1S/C12H18I2/c1-3-11(13)9-7-5-6-8-10(9)12(14)4-2/h3-8H2,1-2H3/b11-9-,12-10- |
| InChIKey | CXSZVWDYIOUULT-HWAYABPNSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.08 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|