C8H8IRf- — CID 134861003
4-iodo-1,2-dimethylbenzene-5-ide;rutherfordium (PubChem CID 134861003) has the molecular formula C8H8IRf- and a molecular weight of 498.06 g/mol. Its IUPAC name is 4-iodo-1,2-dimethylbenzene-5-ide;rutherfordium.
| Compound Name | 4-iodo-1,2-dimethylbenzene-5-ide;rutherfordium |
|---|---|
| PubChem CID | 134861003 |
| Molecular Formula | C8H8IRf- |
| Molecular Weight | 498.06 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 4-iodo-1,2-dimethylbenzene-5-ide;rutherfordium |
| SMILES | Cc1c[c-]c(I)cc1C.[Rf] |
| InChI | InChI=1S/C8H8I.Rf/c1-6-3-4-8(9)5-7(6)2;/h3,5H,1-2H3;/q-1; |
| InChIKey | ZDTYYYJSQUVCQG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.06 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|