C8H10FI — CID 118912038
2-ethyl-3-fluoro-5-iodocyclohexa-1,3-diene (PubChem CID 118912038) has the molecular formula C8H10FI and a molecular weight of 252.07 g/mol. Its IUPAC name is 2-ethyl-3-fluoro-5-iodocyclohexa-1,3-diene.
| Compound Name | 2-ethyl-3-fluoro-5-iodocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 118912038 |
| Molecular Formula | C8H10FI |
| Molecular Weight | 252.07 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 2-ethyl-3-fluoro-5-iodocyclohexa-1,3-diene |
| SMILES | CCC1=CCC(I)C=C1F |
| InChI | InChI=1S/C8H10FI/c1-2-6-3-4-7(10)5-8(6)9/h3,5,7H,2,4H2,1H3 |
| InChIKey | TZXLSWXSCSXRJO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.07 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|