About 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene
1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene (PubChem CID 134898023) has the molecular formula C9H9F
and a molecular weight of 136.17 g/mol. Its IUPAC name is 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene.
Analyze 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene?
The IUPAC name of 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene (CID 134898023) is 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene.
What is the SMILES notation for 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene?
The canonical SMILES for 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene is C=c1cc(F)c(=C)cc1C.
What is the InChIKey of 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene?
The InChIKey is YHOCBLOUSHSECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F/c1-6-4-8(3)9(10)5-7(6)2/h4-5H,2-3H2,1H3.
What are the key properties of 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene?
1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene has a molecular weight of 136.17 g/mol, XLogP of 0.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methyl-3,6-dimethylidenecyclohexa-1,4-diene is sourced from PubChem (CID 134898023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).