C14H24I2 — CID 12981007
(3Z,5Z)-3,6-diiodo-2,2,4,5,7,7-hexamethylocta-3,5-diene (PubChem CID 12981007) has the molecular formula C14H24I2 and a molecular weight of 446.15 g/mol. Its IUPAC name is (3Z,5Z)-3,6-diiodo-2,2,4,5,7,7-hexamethylocta-3,5-diene.
| Compound Name | (3Z,5Z)-3,6-diiodo-2,2,4,5,7,7-hexamethylocta-3,5-diene |
|---|---|
| PubChem CID | 12981007 |
| Molecular Formula | C14H24I2 |
| Molecular Weight | 446.15 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | (3Z,5Z)-3,6-diiodo-2,2,4,5,7,7-hexamethylocta-3,5-diene |
| SMILES | CC(/C(C)=C(\I)C(C)(C)C)=C(/I)C(C)(C)C |
| InChI | InChI=1S/C14H24I2/c1-9(11(15)13(3,4)5)10(2)12(16)14(6,7)8/h1-8H3/b11-9-,12-10- |
| InChIKey | CMIZJSPDRJVIMR-HWAYABPNSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.15 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|