C8H12I2 — CID 155659813
2,3-bis(iodomethyl)-4-methylpenta-1,3-diene (PubChem CID 155659813) has the molecular formula C8H12I2 and a molecular weight of 361.99 g/mol. Its IUPAC name is 2,3-bis(iodomethyl)-4-methylpenta-1,3-diene.
| Compound Name | 2,3-bis(iodomethyl)-4-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 155659813 |
| Molecular Formula | C8H12I2 |
| Molecular Weight | 361.99 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | 2,3-bis(iodomethyl)-4-methylpenta-1,3-diene |
| SMILES | C=C(CI)C(CI)=C(C)C |
| InChI | InChI=1S/C8H12I2/c1-6(2)8(5-10)7(3)4-9/h3-5H2,1-2H3 |
| InChIKey | GRVAOGCRKSSWHT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.99 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|