C10H18I2V — CID 160905465
diiodovanadium;2,3,4,5-tetramethylhexa-2,4-diene (PubChem CID 160905465) has the molecular formula C10H18I2V and a molecular weight of 443.01 g/mol. Its IUPAC name is diiodovanadium;2,3,4,5-tetramethylhexa-2,4-diene.
| Compound Name | diiodovanadium;2,3,4,5-tetramethylhexa-2,4-diene |
|---|---|
| PubChem CID | 160905465 |
| Molecular Formula | C10H18I2V |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.89 |
| IUPAC Name | diiodovanadium;2,3,4,5-tetramethylhexa-2,4-diene |
| SMILES | CC(C)=C(C)C(C)=C(C)C.I[V]I |
| InChI | InChI=1S/C10H18.2HI.V/c1-7(2)9(5)10(6)8(3)4;;;/h1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | SQBUZQZWPDKBNC-UHFFFAOYSA-L |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|