C10H18I2 — CID 143098183
ethene;molecular iodine;2,3,4-trimethylpenta-1,3-diene (PubChem CID 143098183) has the molecular formula C10H18I2 and a molecular weight of 392.06 g/mol. Its IUPAC name is ethene;molecular iodine;2,3,4-trimethylpenta-1,3-diene.
| Compound Name | ethene;molecular iodine;2,3,4-trimethylpenta-1,3-diene |
|---|---|
| PubChem CID | 143098183 |
| Molecular Formula | C10H18I2 |
| Molecular Weight | 392.06 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | ethene;molecular iodine;2,3,4-trimethylpenta-1,3-diene |
| SMILES | C=C.C=C(C)C(C)=C(C)C.II |
| InChI | InChI=1S/C8H14.C2H4.I2/c1-6(2)8(5)7(3)4;2*1-2/h1H2,2-5H3;1-2H2; |
| InChIKey | USJOGMJOOLIPSN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.06 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|