C9H17I3 — CID 91544853
2,3-dimethylpent-2-ene;1,1,1-triiodoethane (PubChem CID 91544853) has the molecular formula C9H17I3 and a molecular weight of 505.95 g/mol. Its IUPAC name is 2,3-dimethylpent-2-ene;1,1,1-triiodoethane.
| Compound Name | 2,3-dimethylpent-2-ene;1,1,1-triiodoethane |
|---|---|
| PubChem CID | 91544853 |
| Molecular Formula | C9H17I3 |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.85 |
| IUPAC Name | 2,3-dimethylpent-2-ene;1,1,1-triiodoethane |
| SMILES | CC(I)(I)I.CCC(C)=C(C)C |
| InChI | InChI=1S/C7H14.C2H3I3/c1-5-7(4)6(2)3;1-2(3,4)5/h5H2,1-4H3;1H3 |
| InChIKey | UDUUSPWZYJFKIA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|