About 6,7-dibutyl-5,8-diiodododeca-5,7-diene
6,7-dibutyl-5,8-diiodododeca-5,7-diene (PubChem CID 71360056) has the molecular formula C20H36I2
and a molecular weight of 530.32 g/mol. Its IUPAC name is 6,7-dibutyl-5,8-diiodododeca-5,7-diene.
Molecular Properties
| Compound Name | 6,7-dibutyl-5,8-diiodododeca-5,7-diene |
| PubChem CID | 71360056 |
| Molecular Formula | C20H36I2 |
| Molecular Weight | 530.32 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 6,7-dibutyl-5,8-diiodododeca-5,7-diene |
| SMILES | CCCCC(I)=C(CCCC)C(CCCC)=C(I)CCCC |
| InChI | InChI=1S/C20H36I2/c1-5-9-13-17(19(21)15-11-7-3)18(14-10-6-2)20(22)16-12-8-4/h5-16H2,1-4H3 |
| InChIKey | BHDPYZPPMLFIIC-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.32 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dibutyl-5,8-diiodododeca-5,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dibutyl-5,8-diiodododeca-5,7-diene?
The IUPAC name of 6,7-dibutyl-5,8-diiodododeca-5,7-diene (CID 71360056) is 6,7-dibutyl-5,8-diiodododeca-5,7-diene.
What is the SMILES notation for 6,7-dibutyl-5,8-diiodododeca-5,7-diene?
The canonical SMILES for 6,7-dibutyl-5,8-diiodododeca-5,7-diene is CCCCC(I)=C(CCCC)C(CCCC)=C(I)CCCC.
What is the InChIKey of 6,7-dibutyl-5,8-diiodododeca-5,7-diene?
The InChIKey is BHDPYZPPMLFIIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36I2/c1-5-9-13-17(19(21)15-11-7-3)18(14-10-6-2)20(22)16-12-8-4/h5-16H2,1-4H3.
What are the key properties of 6,7-dibutyl-5,8-diiodododeca-5,7-diene?
6,7-dibutyl-5,8-diiodododeca-5,7-diene has a molecular weight of 530.32 g/mol, XLogP of 9.13, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dibutyl-5,8-diiodododeca-5,7-diene is sourced from PubChem (CID 71360056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).