C28H34O9S2 — CID 101172971
[(2R,4R)-5-methylsulfonyloxy-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate (PubChem CID 101172971) has the molecular formula C28H34O9S2 and a molecular weight of 578.71 g/mol. Its IUPAC name is [(2R,4R)-5-methylsulfonyloxy-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate.
| Compound Name | [(2R,4R)-5-methylsulfonyloxy-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate |
|---|---|
| PubChem CID | 101172971 |
| Molecular Formula | C28H34O9S2 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | [(2R,4R)-5-methylsulfonyloxy-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H](OCc1ccccc1)C(OCc1ccccc1)[C@@H](COS(C)(=O)=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H34O9S2/c1-38(29,30)36-21-26(33-18-23-12-6-3-7-13-23)28(35-20-25-16-10-5-11-17-25)27(22-37-39(2,31)32)34-19-24-14-8-4-9-15-24/h3-17,26-28H,18-22H2,1-2H3/t26-,27-/m1/s1 |
| InChIKey | ZOQNQZNPURPWEC-KAYWLYCHSA-N |
| XLogP | 3.69 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|