C11H17NO — CID 101173596
(2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one (PubChem CID 101173596) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one.
| Compound Name | (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one |
|---|---|
| PubChem CID | 101173596 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one |
| SMILES | C=CC[C@H]1C(=O)C[C@H](C)N1CC=C |
| InChI | InChI=1S/C11H17NO/c1-4-6-10-11(13)8-9(3)12(10)7-5-2/h4-5,9-10H,1-2,6-8H2,3H3/t9-,10-/m0/s1 |
| InChIKey | MDBGDLXNJTUXNF-UWVGGRQHSA-N |
| XLogP | 1.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|