About (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one
(2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one (PubChem CID 101173596) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one.
Molecular Properties
| Compound Name | (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one |
| PubChem CID | 101173596 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one |
| SMILES | C=CC[C@H]1C(=O)C[C@H](C)N1CC=C |
| InChI | InChI=1S/C11H17NO/c1-4-6-10-11(13)8-9(3)12(10)7-5-2/h4-5,9-10H,1-2,6-8H2,3H3/t9-,10-/m0/s1 |
| InChIKey | MDBGDLXNJTUXNF-UWVGGRQHSA-N |
| XLogP | 1.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one?
The IUPAC name of (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one (CID 101173596) is (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one.
What is the SMILES notation for (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one?
The canonical SMILES for (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one is C=CC[C@H]1C(=O)C[C@H](C)N1CC=C.
What is the InChIKey of (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one?
The InChIKey is MDBGDLXNJTUXNF-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H17NO/c1-4-6-10-11(13)8-9(3)12(10)7-5-2/h4-5,9-10H,1-2,6-8H2,3H3/t9-,10-/m0/s1.
What are the key properties of (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one?
(2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one has a molecular weight of 179.26 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-5-methyl-1,2-bis(prop-2-enyl)pyrrolidin-3-one is sourced from PubChem (CID 101173596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).