C4H11N2O3P-2 — CID 101174409
2-(2-aminoethylamino)ethyl-trioxidophosphanium (PubChem CID 101174409) has the molecular formula C4H11N2O3P-2 and a molecular weight of 166.12 g/mol. Its IUPAC name is 2-(2-aminoethylamino)ethyl-trioxidophosphanium.
| Compound Name | 2-(2-aminoethylamino)ethyl-trioxidophosphanium |
|---|---|
| PubChem CID | 101174409 |
| Molecular Formula | C4H11N2O3P-2 |
| Molecular Weight | 166.12 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 2-(2-aminoethylamino)ethyl-trioxidophosphanium |
| SMILES | NCCNCC[P+]([O-])([O-])[O-] |
| InChI | InChI=1S/C4H13N2O3P/c5-1-2-6-3-4-10(7,8)9/h6H,1-5H2,(H2,7,8,9)/p-2 |
| InChIKey | DDOJGXVUFMXNKA-UHFFFAOYSA-L |
| XLogP | -3.62 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.12 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|